Products 2379460-04-3

CAS 2379460-04-3 is the registry number for 9-Chloronaphtho[2,1-b]benzofuran, 99.9%, 99.9%. Offered by: Chemat. Available pack sizes: 25g, 100g, 250g, 1kg.

Structural formula: {0} (CAS {1})

9-chloronaphtho[2,1-b][1]benzofuran (CAS 2379460-04-3) is a chemical compound with the molecular formula C16H9ClO and a molecular weight of 252.69 g/mol. IUPAC name: 9-chloronaphtho[2,1-b][1]benzofuran. InChIKey: AGLNLUPDODYWMN-UHFFFAOYSA-N.

Identity
Molecular formulaC16H9ClO
Molecular weight252.69 g/mol
IUPAC name9-chloronaphtho[2,1-b][1]benzofuran
InChIKeyAGLNLUPDODYWMN-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC3=C2C4=C(O3)C=C(C=C4)Cl

Computed by PubChem (NCBI)