CAS 2379460-04-3 is the registry number for 9-Chloronaphtho[2,1-b]benzofuran, 99.9%, 99.9%. Offered by: Chemat. Available pack sizes: 25g, 100g, 250g, 1kg.
9-chloronaphtho[2,1-b][1]benzofuran (CAS 2379460-04-3) is a chemical compound with the molecular formula C16H9ClO and a molecular weight of 252.69 g/mol. IUPAC name: 9-chloronaphtho[2,1-b][1]benzofuran. InChIKey: AGLNLUPDODYWMN-UHFFFAOYSA-N.
| Molecular formula | C16H9ClO |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | 9-chloronaphtho[2,1-b][1]benzofuran |
| InChIKey | AGLNLUPDODYWMN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=C(O3)C=C(C=C4)Cl |
Computed by PubChem (NCBI)