Products 2140822-95-1
CAS 2140822-95-1 appears in our catalog under these names: 10-Chloronaphtho[2,1-b]benzofuran, 98%, 10-Chlorobenzo[b]naphtho[1,2-d]furan, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
10-chloronaphtho[2,1-b][1]benzofuran (CAS 2140822-95-1) is a chemical compound with the molecular formula C16H9ClO and a molecular weight of 252.69 g/mol. IUPAC name: 10-chloronaphtho[2,1-b][1]benzofuran. InChIKey: FNULZJHNXGVSLD-UHFFFAOYSA-N.
| Molecular formula | C16H9ClO |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | 10-chloronaphtho[2,1-b][1]benzofuran |
| InChIKey | FNULZJHNXGVSLD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C4=C(O3)C=CC(=C4)Cl |
Computed by PubChem (NCBI)