CAS 2271091-81-5 is the registry number for 4-Chloronaphtho[2,3-b]benzofuran, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg.
4-chloronaphtho[2,3-b][1]benzofuran (CAS 2271091-81-5) is a chemical compound with the molecular formula C16H9ClO and a molecular weight of 252.69 g/mol. IUPAC name: 4-chloronaphtho[2,3-b][1]benzofuran. InChIKey: VSOFDLVTWVMGCL-UHFFFAOYSA-N.
| Molecular formula | C16H9ClO |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | 4-chloronaphtho[2,3-b][1]benzofuran |
| InChIKey | VSOFDLVTWVMGCL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C4=C(O3)C(=CC=C4)Cl |
Computed by PubChem (NCBI)