CAS 2170644-12-7 appears in our catalog under these names: 1-Chlorobenzo[b]naphtho[2,3-d]furan, 97%, 97%, 1-Chloronaphtho[2,3-b]benzofuran, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100mg, 250mg, 1g.
1-chloronaphtho[2,3-b][1]benzofuran (CAS 2170644-12-7) is a chemical compound with the molecular formula C16H9ClO and a molecular weight of 252.69 g/mol. IUPAC name: 1-chloronaphtho[2,3-b][1]benzofuran. InChIKey: YNPIRTDONNKWJW-UHFFFAOYSA-N.
| Molecular formula | C16H9ClO |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | 1-chloronaphtho[2,3-b][1]benzofuran |
| InChIKey | YNPIRTDONNKWJW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C4=C(O3)C=CC=C4Cl |
Computed by PubChem (NCBI)