CAS 1416620-13-7 is the registry number for 9-Chloronaphtho[1,2-b]benzofuran, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
9-chloronaphtho[1,2-b][1]benzofuran (CAS 1416620-13-7) is a chemical compound with the molecular formula C16H9ClO and a molecular weight of 252.69 g/mol. IUPAC name: 9-chloronaphtho[1,2-b][1]benzofuran. InChIKey: QYBMPDUADJFPKZ-UHFFFAOYSA-N.
| Molecular formula | C16H9ClO |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | 9-chloronaphtho[1,2-b][1]benzofuran |
| InChIKey | QYBMPDUADJFPKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2OC4=C3C=CC(=C4)Cl |
Computed by PubChem (NCBI)