CAS 2397634-71-6 is the registry number for 3-Chloronaphtho[2,3-b]benzofuran, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloronaphtho[2,3-b][1]benzofuran (CAS 2397634-71-6) is a chemical compound with the molecular formula C16H9ClO and a molecular weight of 252.69 g/mol. IUPAC name: 3-chloronaphtho[2,3-b][1]benzofuran. InChIKey: OCPJSHAVYMWVBI-UHFFFAOYSA-N.
| Molecular formula | C16H9ClO |
|---|---|
| Molecular weight | 252.69 g/mol |
| IUPAC name | 3-chloronaphtho[2,3-b][1]benzofuran |
| InChIKey | OCPJSHAVYMWVBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C4=C(O3)C=C(C=C4)Cl |
Computed by PubChem (NCBI)