Products 2103931-83-3

CAS 2103931-83-3 is the registry number for 10-Chloronaphtho[1,2-b]benzofuran, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 15g, 25g.

Structural formula: {0} (CAS {1})

10-chloronaphtho[1,2-b][1]benzofuran (CAS 2103931-83-3) is a chemical compound with the molecular formula C16H9ClO and a molecular weight of 252.69 g/mol. IUPAC name: 10-chloronaphtho[1,2-b][1]benzofuran. InChIKey: HVVCLHJYDCMSEB-UHFFFAOYSA-N.

Identity
Molecular formulaC16H9ClO
Molecular weight252.69 g/mol
IUPAC name10-chloronaphtho[1,2-b][1]benzofuran
InChIKeyHVVCLHJYDCMSEB-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=CC3=C2OC4=C3C=CC=C4Cl

Computed by PubChem (NCBI)