Products 2274791-00-1

CAS 2274791-00-1 is the registry number for 2-Chlorobenzo[b]naphtho[2,1-d]furan, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

2-chloronaphtho[1,2-b][1]benzofuran (CAS 2274791-00-1) is a chemical compound with the molecular formula C16H9ClO and a molecular weight of 252.69 g/mol. IUPAC name: 2-chloronaphtho[1,2-b][1]benzofuran. InChIKey: XMLDILASQWSUNY-UHFFFAOYSA-N.

Identity
Molecular formulaC16H9ClO
Molecular weight252.69 g/mol
IUPAC name2-chloronaphtho[1,2-b][1]benzofuran
InChIKeyXMLDILASQWSUNY-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C3=C(O2)C4=C(C=CC(=C4)Cl)C=C3

Computed by PubChem (NCBI)