Products 1803567-54-5
CAS 1803567-54-5 appears in our catalog under these names: 2-(Pyridin-4-yloxy)benzoic acid hydrochloride, 95%, 2-(Pyridin-4-yloxy)benzoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-pyridin-4-yloxybenzoic acid;hydrochloride (CAS 1803567-54-5) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: 2-pyridin-4-yloxybenzoic acid;hydrochloride. InChIKey: ISTVYWHBDJLERG-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 2-pyridin-4-yloxybenzoic acid;hydrochloride |
| InChIKey | ISTVYWHBDJLERG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OC2=CC=NC=C2.Cl |
Computed by PubChem (NCBI)