CAS 1803586-82-4 appears in our catalog under these names: Ethyl 2-(1-methyl-1H-pyrazole-4-carbonyloxy)-3-oxobutanoate, 95%, Ethyl 2-(1-methyl-1H-pyrazole-4-carbonyloxy)-3-oxobutanoate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1-ethoxy-1,3-dioxobutan-2-yl) 1-methylpyrazole-4-carboxylate (CAS 1803586-82-4) is a chemical compound with the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. IUPAC name: (1-ethoxy-1,3-dioxobutan-2-yl) 1-methylpyrazole-4-carboxylate. InChIKey: UIULOIWMTKAEFX-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O5 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | (1-ethoxy-1,3-dioxobutan-2-yl) 1-methylpyrazole-4-carboxylate |
| InChIKey | UIULOIWMTKAEFX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)C)OC(=O)C1=CN(N=C1)C |
Computed by PubChem (NCBI)