Products 1803786-19-7

CAS 1803786-19-7 is the registry number for Methyl 4,5-dibromonicotinate 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4,5-dibromopyridine-3-carboxylate (CAS 1803786-19-7) is a chemical compound with the molecular formula C7H5Br2NO2 and a molecular weight of 294.93 g/mol. IUPAC name: methyl 4,5-dibromopyridine-3-carboxylate. InChIKey: GCBHUOAHSYQVSB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Br2NO2
Molecular weight294.93 g/mol
IUPAC namemethyl 4,5-dibromopyridine-3-carboxylate
InChIKeyGCBHUOAHSYQVSB-UHFFFAOYSA-N
SMILESCOC(=O)C1=CN=CC(=C1Br)Br

Computed by PubChem (NCBI)