CAS 1803857-00-2 is the registry number for 2-Ethoxy-5-nitro-1,3-benzoxazole, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-ethoxy-5-nitro-1,3-benzoxazole (CAS 1803857-00-2) is a chemical compound with the molecular formula C9H8N2O4 and a molecular weight of 208.17 g/mol. IUPAC name: 2-ethoxy-5-nitro-1,3-benzoxazole. InChIKey: ZPAALTJALBYTDM-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O4 |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | 2-ethoxy-5-nitro-1,3-benzoxazole |
| InChIKey | ZPAALTJALBYTDM-UHFFFAOYSA-N |
| SMILES | CCOC1=NC2=C(O1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)