Products 1804408-94-3
CAS 1804408-94-3 appears in our catalog under these names: Ethyl 2-bromo-3,6-difluorobenzoate, 95%, Ethyl 2-bromo-3,6-difluorobenzoate, ≥95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
Ethyl 2-bromo-3,6-difluorobenzoate (CAS 1804408-94-3) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: ethyl 2-bromo-3,6-difluorobenzoate. InChIKey: OINNREUSPXXOMX-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | ethyl 2-bromo-3,6-difluorobenzoate |
| InChIKey | OINNREUSPXXOMX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1Br)F)F |
Computed by PubChem (NCBI)