Products 1805594-12-0
CAS 1805594-12-0 is the registry number for 2-(2-Bromo-4,6-difluorophenyl)acetonitrile, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-(2-bromo-4,6-difluorophenyl)acetonitrile (CAS 1805594-12-0) is a chemical compound with the molecular formula C8H4BrF2N and a molecular weight of 232.02 g/mol. IUPAC name: 2-(2-bromo-4,6-difluorophenyl)acetonitrile. InChIKey: INSKDTANOZJUTG-UHFFFAOYSA-N.
| Molecular formula | C8H4BrF2N |
|---|---|
| Molecular weight | 232.02 g/mol |
| IUPAC name | 2-(2-bromo-4,6-difluorophenyl)acetonitrile |
| InChIKey | INSKDTANOZJUTG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CC#N)Br)F |
Computed by PubChem (NCBI)