Products 1806276-27-6
CAS 1806276-27-6 is the registry number for Ethyl 4,5-Dichloropicolinate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 4,5-dichloropyridine-2-carboxylate (CAS 1806276-27-6) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: ethyl 4,5-dichloropyridine-2-carboxylate. InChIKey: NAVADJOGSGZSOL-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | ethyl 4,5-dichloropyridine-2-carboxylate |
| InChIKey | NAVADJOGSGZSOL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(C(=C1)Cl)Cl |
Computed by PubChem (NCBI)