CAS 1807040-78-3 appears in our catalog under these names: Methyl 2-(4-bromo-2,3-difluorophenyl)acetate, 97%, Methyl 2-(4-bromo-2,3-difluorophenyl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Methyl 2-(4-bromo-2,3-difluorophenyl)acetate (CAS 1807040-78-3) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: methyl 2-(4-bromo-2,3-difluorophenyl)acetate. InChIKey: ZOCSEODXLDNTGM-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | methyl 2-(4-bromo-2,3-difluorophenyl)acetate |
| InChIKey | ZOCSEODXLDNTGM-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C(=C(C=C1)Br)F)F |
Computed by PubChem (NCBI)