CAS 1807243-91-9 is the registry number for Ethyl 2-bromo-4,6-difluorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
Ethyl 2-bromo-4,6-difluorobenzoate (CAS 1807243-91-9) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: ethyl 2-bromo-4,6-difluorobenzoate. InChIKey: FKRBENKRKPIYFR-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | ethyl 2-bromo-4,6-difluorobenzoate |
| InChIKey | FKRBENKRKPIYFR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1Br)F)F |
Computed by PubChem (NCBI)