Products 1808997-86-5
CAS 1808997-86-5 appears in our catalog under these names: (2,4-Difluoro-6-methoxyphenyl)boronic Acid, >95% (HPLC), (2,4-Difluoro-6-methoxyphenyl)boronic acid 97%, (2,4-difluoro-6-methoxyphenyl)boronic acid, 97%, 97%, 2,4-DIFLUORO-6-METHOXYPHENYLBORONIC ACID, 96%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 500mg, 250mg, 5g, 10g.
(2,4-difluoro-6-methoxyphenyl)boronic acid (CAS 1808997-86-5) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (2,4-difluoro-6-methoxyphenyl)boronic acid. InChIKey: PYRDVIXFPCTKFD-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (2,4-difluoro-6-methoxyphenyl)boronic acid |
| InChIKey | PYRDVIXFPCTKFD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)F)OC)(O)O |
Computed by PubChem (NCBI)