CAS 1809337-05-0 is the registry number for Methyl 5-bromo-3,4-dihydroxy-2-methylbenzoate, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Methyl 5-bromo-3,4-dihydroxy-2-methylbenzoate (CAS 1809337-05-0) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: methyl 5-bromo-3,4-dihydroxy-2-methylbenzoate. InChIKey: RGYDBEIUMQUVHW-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | methyl 5-bromo-3,4-dihydroxy-2-methylbenzoate |
| InChIKey | RGYDBEIUMQUVHW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1C(=O)OC)Br)O)O |
Computed by PubChem (NCBI)