CAS 1955562-11-4 appears in our catalog under these names: 8-Bromochroman-4-amine hydrochloride, 98%, 8-Bromochroman-4-amine hydrochloride, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride (CAS 1955562-11-4) is a chemical compound with the molecular formula C9H11BrClNO and a molecular weight of 264.54 g/mol. IUPAC name: 8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride. InChIKey: GQVQWQSPIBHZSG-UHFFFAOYSA-N.
| Molecular formula | C9H11BrClNO |
|---|---|
| Molecular weight | 264.54 g/mol |
| IUPAC name | 8-bromo-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| InChIKey | GQVQWQSPIBHZSG-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1N)C=CC=C2Br.Cl |
Computed by PubChem (NCBI)