CAS 18110-73-1 is the registry number for 3-Methyl-6H-benzo(c)chromen-6-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
3-methylbenzo[c]chromen-6-one (CAS 18110-73-1) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 3-methylbenzo[c]chromen-6-one. InChIKey: DNISIZHISDUPRT-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 3-methylbenzo[c]chromen-6-one |
| InChIKey | DNISIZHISDUPRT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=CC=CC=C3C(=O)O2 |
Computed by PubChem (NCBI)