CAS 1814881-35-0 is the registry number for 7-Methoxy-3,4-dihydro-1H-pyrano[3,4-b]quinolin-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methoxy-3,4-dihydropyrano[3,4-b]quinolin-1-one (CAS 1814881-35-0) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 7-methoxy-3,4-dihydropyrano[3,4-b]quinolin-1-one. InChIKey: ZDTSKIBUNYQROO-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 7-methoxy-3,4-dihydropyrano[3,4-b]quinolin-1-one |
| InChIKey | ZDTSKIBUNYQROO-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC3=C(C(=O)OCC3)N=C2C=C1 |
Computed by PubChem (NCBI)