Products 1820717-24-5
CAS 1820717-24-5 is the registry number for 2-amino-6-chloro-1,3-benzoxazol-5-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-6-chloro-1,3-benzoxazol-5-ol (CAS 1820717-24-5) is a chemical compound with the molecular formula C7H5ClN2O2 and a molecular weight of 184.58 g/mol. IUPAC name: 2-amino-6-chloro-1,3-benzoxazol-5-ol. InChIKey: MYVLRXOYBVBNIW-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2 |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | 2-amino-6-chloro-1,3-benzoxazol-5-ol |
| InChIKey | MYVLRXOYBVBNIW-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1O)Cl)OC(=N2)N |
Computed by PubChem (NCBI)