CAS 105544-39-6 is the registry number for 7-Chloro-2h-pyrido[2,3-b]-1,4-oxazin-3(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-chloro-1H-pyrido[2,3-b][1,4]oxazin-2-one (CAS 105544-39-6) is a chemical compound with the molecular formula C7H5ClN2O2 and a molecular weight of 184.58 g/mol. IUPAC name: 6-chloro-1H-pyrido[2,3-b][1,4]oxazin-2-one. InChIKey: QZCXKQHUJLFAAJ-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2 |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | 6-chloro-1H-pyrido[2,3-b][1,4]oxazin-2-one |
| InChIKey | QZCXKQHUJLFAAJ-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)N=C(C=C2)Cl |
Computed by PubChem (NCBI)