CAS 2065250-37-3 is the registry number for 7-Chloro-1h-pyrido[2,3-b][1,4]oxazin-2-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
7-chloro-1H-pyrido[2,3-b][1,4]oxazin-2-ol (CAS 2065250-37-3) is a chemical compound with the molecular formula C7H5ClN2O2 and a molecular weight of 184.58 g/mol. IUPAC name: 7-chloro-1H-pyrido[2,3-b][1,4]oxazin-2-ol. InChIKey: PFNVCUNQNMGBFM-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2 |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | 7-chloro-1H-pyrido[2,3-b][1,4]oxazin-2-ol |
| InChIKey | PFNVCUNQNMGBFM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1NC(=CO2)O)Cl |
Computed by PubChem (NCBI)