CAS 205748-05-6 appears in our catalog under these names: 7-Chloro-2h-pyrido[3,2-b][1,4]oxazin-3(4h)-one, 95%, 7-Chloro-2H-pyrido(3,2-B)-1,4-oxazin-3(4H)-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 1000mg, 500mg, 2000mg, 5000mg.
7-chloro-4H-pyrido[3,2-b][1,4]oxazin-3-one (CAS 205748-05-6) is a chemical compound with the molecular formula C7H5ClN2O2 and a molecular weight of 184.58 g/mol. IUPAC name: 7-chloro-4H-pyrido[3,2-b][1,4]oxazin-3-one. InChIKey: SMDOTALDDUVRMH-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2 |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | 7-chloro-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| InChIKey | SMDOTALDDUVRMH-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C=N2)Cl |
Computed by PubChem (NCBI)