CAS 501653-22-1 appears in our catalog under these names: 5-(Chloromethyl)-3-(2-furyl)-1,2,4-oxadiazole, 95%, 5-(Chloromethyl)-3-(2-furyl)-1,2,4-oxadiazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 2,5g.
5-(chloromethyl)-3-(furan-2-yl)-1,2,4-oxadiazole (CAS 501653-22-1) is a chemical compound with the molecular formula C7H5ClN2O2 and a molecular weight of 184.58 g/mol. IUPAC name: 5-(chloromethyl)-3-(furan-2-yl)-1,2,4-oxadiazole. InChIKey: OJQHUMFLEARHQO-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2 |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | 5-(chloromethyl)-3-(furan-2-yl)-1,2,4-oxadiazole |
| InChIKey | OJQHUMFLEARHQO-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)