CAS 1198154-62-9 is the registry number for 8-Chloro-1h,2h,3h-pyrido[2,3-b][1,4]oxazin-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
8-chloro-1H-pyrido[2,3-b][1,4]oxazin-2-one (CAS 1198154-62-9) is a chemical compound with the molecular formula C7H5ClN2O2 and a molecular weight of 184.58 g/mol. IUPAC name: 8-chloro-1H-pyrido[2,3-b][1,4]oxazin-2-one. InChIKey: UCYJENXXRAZUTD-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2 |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | 8-chloro-1H-pyrido[2,3-b][1,4]oxazin-2-one |
| InChIKey | UCYJENXXRAZUTD-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=CN=C2O1)Cl |
Computed by PubChem (NCBI)