CAS 1260811-66-2 appears in our catalog under these names: 5-Chloro-1h-pyrido[3,4-b][1,4]oxazin-2(3h)-one, 95%, 5–Chloro–1H–pyrido(3,4–b)(1,4)oxazin–2(3H)–one, 5-Chloro-1H-pyrido[3,4-b][1,4]oxazin-2(3H)-one, 97%, 97%, 5-CHLORO-1H-PYRIDO[3,4-B][1,4]OXAZIN-2(3H)-ONE, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
5-chloro-1H-pyrido[3,4-b][1,4]oxazin-2-one (CAS 1260811-66-2) is a chemical compound with the molecular formula C7H5ClN2O2 and a molecular weight of 184.58 g/mol. IUPAC name: 5-chloro-1H-pyrido[3,4-b][1,4]oxazin-2-one. InChIKey: FHNIOFLISORNMS-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2 |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | 5-chloro-1H-pyrido[3,4-b][1,4]oxazin-2-one |
| InChIKey | FHNIOFLISORNMS-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C(=NC=C2)Cl |
Computed by PubChem (NCBI)