CAS 727374-86-9 is the registry number for 2-(Chloromethyl)-5-(2-furyl)-1,3,4-oxadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
2-(chloromethyl)-5-(furan-2-yl)-1,3,4-oxadiazole (CAS 727374-86-9) is a chemical compound with the molecular formula C7H5ClN2O2 and a molecular weight of 184.58 g/mol. IUPAC name: 2-(chloromethyl)-5-(furan-2-yl)-1,3,4-oxadiazole. InChIKey: ITPFFLTUPKAJHE-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2 |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | 2-(chloromethyl)-5-(furan-2-yl)-1,3,4-oxadiazole |
| InChIKey | ITPFFLTUPKAJHE-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NN=C(O2)CCl |
Computed by PubChem (NCBI)