Products 278614-92-9
CAS 278614-92-9 appears in our catalog under these names: 5-Chloro-2-methyl-7h-isoxazolo[2,3-a]pyrimidin-7-one, 96%, 5-Chloro-2-methyl-7h-isoxazolo(2,3-a)pyrimidin-7-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 0,5g, 50mg.
5-chloro-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-7-one (CAS 278614-92-9) is a chemical compound with the molecular formula C7H5ClN2O2 and a molecular weight of 184.58 g/mol. IUPAC name: 5-chloro-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-7-one. InChIKey: XNAWHAKTUSSDKH-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN2O2 |
|---|---|
| Molecular weight | 184.58 g/mol |
| IUPAC name | 5-chloro-2-methyl-[1,2]oxazolo[2,3-a]pyrimidin-7-one |
| InChIKey | XNAWHAKTUSSDKH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC(=CC(=O)N2O1)Cl |
Computed by PubChem (NCBI)