CAS 1823338-14-2 appears in our catalog under these names: 4,7-Dichlorothieno[3,2-d]pyrimidine, 95+%, 95+%, 4,7-Dichlorothieno[3,2-d]pyrimidine, 95+%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4,7-dichlorothieno[3,2-d]pyrimidine (CAS 1823338-14-2) is a chemical compound with the molecular formula C6H2Cl2N2S and a molecular weight of 205.06 g/mol. IUPAC name: 4,7-dichlorothieno[3,2-d]pyrimidine. InChIKey: UQUFNEZHBCHIMK-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2N2S |
|---|---|
| Molecular weight | 205.06 g/mol |
| IUPAC name | 4,7-dichlorothieno[3,2-d]pyrimidine |
| InChIKey | UQUFNEZHBCHIMK-UHFFFAOYSA-N |
| SMILES | C1=C(C2=C(S1)C(=NC=N2)Cl)Cl |
Computed by PubChem (NCBI)