CAS 1824105-71-6 appears in our catalog under these names: 7-Ethynyl-1h,2h,3h-pyrido[2,3-b][1,4]oxazin-2-one, 95%, 7-EThynyl-1h,2h,3h-pyrido(2,3-b)(1,4)oxazin-2-one, 95%, 7-Ethynyl-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg.
7-ethynyl-1H-pyrido[2,3-b][1,4]oxazin-2-one (CAS 1824105-71-6) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 7-ethynyl-1H-pyrido[2,3-b][1,4]oxazin-2-one. InChIKey: XCYIASWVODNQCX-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 7-ethynyl-1H-pyrido[2,3-b][1,4]oxazin-2-one |
| InChIKey | XCYIASWVODNQCX-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(N=C1)OCC(=O)N2 |
Computed by PubChem (NCBI)