CAS 1824123-04-7 appears in our catalog under these names: 7-Ethynyl-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one, ≥95%, ≥95%, 7-ETHYNYL-2H-PYRIDO[3,2-B][1,4]OXAZIN-3(4H)-ONE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-ethynyl-4H-pyrido[3,2-b][1,4]oxazin-3-one (CAS 1824123-04-7) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 7-ethynyl-4H-pyrido[3,2-b][1,4]oxazin-3-one. InChIKey: XIVONTWDADBNCF-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 7-ethynyl-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| InChIKey | XIVONTWDADBNCF-UHFFFAOYSA-N |
| SMILES | C#CC1=CC2=C(NC(=O)CO2)N=C1 |
Computed by PubChem (NCBI)