Products 1824277-56-6
CAS 1824277-56-6 is the registry number for 5-Hydroxy-3-phenylisoxazole-4-carboxylic acid, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid (CAS 1824277-56-6) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid. InChIKey: TVRRJFOWSUQKDI-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 5-oxo-3-phenyl-2H-1,2-oxazole-4-carboxylic acid |
| InChIKey | TVRRJFOWSUQKDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)ON2)C(=O)O |
Computed by PubChem (NCBI)