Products 1826025-72-2
CAS 1826025-72-2 is the registry number for 5-(3-hydroxy-4-methoxyphenyl)-1,2-oxazole-3-carboxylic acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-(3-hydroxy-4-methoxyphenyl)-1,2-oxazole-3-carboxylic acid (CAS 1826025-72-2) is a chemical compound with the molecular formula C11H9NO5 and a molecular weight of 235.19 g/mol. IUPAC name: 5-(3-hydroxy-4-methoxyphenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: DVJCSFONHJUIFD-UHFFFAOYSA-N.
| Molecular formula | C11H9NO5 |
|---|---|
| Molecular weight | 235.19 g/mol |
| IUPAC name | 5-(3-hydroxy-4-methoxyphenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | DVJCSFONHJUIFD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC(=NO2)C(=O)O)O |
Computed by PubChem (NCBI)