Products 18268-69-4
CAS 18268-69-4 is the registry number for 5,6-Dichlorovanillin. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,3-dichloro-4-hydroxy-5-methoxybenzaldehyde (CAS 18268-69-4) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 2,3-dichloro-4-hydroxy-5-methoxybenzaldehyde. InChIKey: LQDPWXPJJUUISU-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 2,3-dichloro-4-hydroxy-5-methoxybenzaldehyde |
| InChIKey | LQDPWXPJJUUISU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C=O)Cl)Cl)O |
Computed by PubChem (NCBI)