Products 18461-66-0
CAS 18461-66-0 is the registry number for Phenazopyridine Impurity 12. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
6-butan-2-yl-3-methyl-2,4-dinitrophenol (CAS 18461-66-0) is a chemical compound with the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. IUPAC name: 6-butan-2-yl-3-methyl-2,4-dinitrophenol. InChIKey: VXMMDZSFKWDUDJ-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O5 |
|---|---|
| Molecular weight | 254.24 g/mol |
| IUPAC name | 6-butan-2-yl-3-methyl-2,4-dinitrophenol |
| InChIKey | VXMMDZSFKWDUDJ-UHFFFAOYSA-N |
| SMILES | CCC(C)C1=CC(=C(C(=C1O)[N+](=O)[O-])C)[N+](=O)[O-] |
Computed by PubChem (NCBI)