CAS 184904-69-6 is the registry number for 1-Methyl-2,3-dioxoindoline-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-methyl-2,3-dioxoindole-5-carboxylic acid (CAS 184904-69-6) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 1-methyl-2,3-dioxoindole-5-carboxylic acid. InChIKey: ROPLRWWORDJINQ-UHFFFAOYSA-N.
| Molecular formula | C10H7NO4 |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 1-methyl-2,3-dioxoindole-5-carboxylic acid |
| InChIKey | ROPLRWWORDJINQ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C(=O)O)C(=O)C1=O |
Computed by PubChem (NCBI)