Products 184904-69-6

CAS 184904-69-6 is the registry number for 1-Methyl-2,3-dioxoindoline-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

1-methyl-2,3-dioxoindole-5-carboxylic acid (CAS 184904-69-6) is a chemical compound with the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. IUPAC name: 1-methyl-2,3-dioxoindole-5-carboxylic acid. InChIKey: ROPLRWWORDJINQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7NO4
Molecular weight205.17 g/mol
IUPAC name1-methyl-2,3-dioxoindole-5-carboxylic acid
InChIKeyROPLRWWORDJINQ-UHFFFAOYSA-N
SMILESCN1C2=C(C=C(C=C2)C(=O)O)C(=O)C1=O

Computed by PubChem (NCBI)