Products 185621-28-7
CAS 185621-28-7 is the registry number for Benzyl 4-formyl-1H-pyrrole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Benzyl 4-formyl-1H-pyrrole-2-carboxylate (CAS 185621-28-7) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: benzyl 4-formyl-1H-pyrrole-2-carboxylate. InChIKey: NDEPHKDCOCSLFM-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | benzyl 4-formyl-1H-pyrrole-2-carboxylate |
| InChIKey | NDEPHKDCOCSLFM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC(=CN2)C=O |
Computed by PubChem (NCBI)