Products 185683-71-0
CAS 185683-71-0 is the registry number for rac-(1R,5S)-1-Phenyl-3-oxabicyclo(3.1.0)hexane-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,25g, 25mg.
(1R)-1-phenyl-3-oxabicyclo[3.1.0]hexane-2,4-dione (CAS 185683-71-0) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: (1R)-1-phenyl-3-oxabicyclo[3.1.0]hexane-2,4-dione. InChIKey: VRVFLPPXIRCEOE-LYNSQETBSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | (1R)-1-phenyl-3-oxabicyclo[3.1.0]hexane-2,4-dione |
| InChIKey | VRVFLPPXIRCEOE-LYNSQETBSA-N |
| SMILES | C1C2[C@@]1(C(=O)OC2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)