CAS 710-97-4 appears in our catalog under these names: 1-Phenyl-3-oxabicyclo(3.1.0)hexane-2,4-dione, 95%, 1-Phenyl-3-oxabicyclo(3.1.0)hexane-2,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-phenyl-3-oxabicyclo[3.1.0]hexane-2,4-dione (CAS 710-97-4) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 1-phenyl-3-oxabicyclo[3.1.0]hexane-2,4-dione. InChIKey: VRVFLPPXIRCEOE-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 1-phenyl-3-oxabicyclo[3.1.0]hexane-2,4-dione |
| InChIKey | VRVFLPPXIRCEOE-UHFFFAOYSA-N |
| SMILES | C1C2C1(C(=O)OC2=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)