CAS 1862407-93-9 is the registry number for CYCLOPROPYL 4-BROMOBENZOATE, 95%+, 95%+. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Cyclopropyl 4-bromobenzoate (CAS 1862407-93-9) is a chemical compound with the molecular formula C10H9BrO2 and a molecular weight of 241.08 g/mol. IUPAC name: cyclopropyl 4-bromobenzoate. InChIKey: PMGCCOBKICXXSV-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO2 |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | cyclopropyl 4-bromobenzoate |
| InChIKey | PMGCCOBKICXXSV-UHFFFAOYSA-N |
| SMILES | C1CC1OC(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)