Products 1864061-10-8
CAS 1864061-10-8 is the registry number for 5-Fluoro-6-hydroxy-2,3-dihydro-1H-indole-2,3-dione. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg, 250mg, 500mg.
5-fluoro-6-hydroxy-1H-indole-2,3-dione (CAS 1864061-10-8) is a chemical compound with the molecular formula C8H4FNO3 and a molecular weight of 181.12 g/mol. IUPAC name: 5-fluoro-6-hydroxy-1H-indole-2,3-dione. InChIKey: MYNSTCMJWWUTJJ-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO3 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 5-fluoro-6-hydroxy-1H-indole-2,3-dione |
| InChIKey | MYNSTCMJWWUTJJ-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)O)NC(=O)C2=O |
Computed by PubChem (NCBI)