Products 1864971-22-1

CAS 1864971-22-1 is the registry number for 2-Hydroxy-3-(1-oxidothiomorpholino)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-hydroxy-3-(1-oxo-1,4-thiazinan-4-yl)propanoic acid (CAS 1864971-22-1) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: 2-hydroxy-3-(1-oxo-1,4-thiazinan-4-yl)propanoic acid. InChIKey: FLSPGLGEOZISRX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13NO4S
Molecular weight207.25 g/mol
IUPAC name2-hydroxy-3-(1-oxo-1,4-thiazinan-4-yl)propanoic acid
InChIKeyFLSPGLGEOZISRX-UHFFFAOYSA-N
SMILESC1CS(=O)CCN1CC(C(=O)O)O

Computed by PubChem (NCBI)