CAS 1877-71-0 appears in our catalog under these names: Monomethyl Isophthalate, Monomethyl Isophthalate, Methyl hydrogen isophthalate, 97% , Monomethyl Isophthalate, >97.0%(GC), mono-Methyl isophthalate, 97%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 10g, 1g, 5g, 25g, 100g, 500g, 50g, 250g.
3-methoxycarbonylbenzoic acid (CAS 1877-71-0) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 3-methoxycarbonylbenzoic acid. InChIKey: WMZNGTSLFSJHMZ-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 3-methoxycarbonylbenzoic acid |
| InChIKey | WMZNGTSLFSJHMZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C(=O)O |
Computed by PubChem (NCBI)