Products 188795-80-4
CAS 188795-80-4 is the registry number for 5'-Amino-[2,2'-bipyridine]-5-carboxylic acid xhydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
6-(5-amino-2-pyridinyl)pyridine-3-carboxylic acid;hydrochloride (CAS 188795-80-4) is a chemical compound with the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. IUPAC name: 6-(5-amino-2-pyridinyl)pyridine-3-carboxylic acid;hydrochloride. InChIKey: OIPGEDQOUIZYAB-UHFFFAOYSA-N.
| Molecular formula | C11H10ClN3O2 |
|---|---|
| Molecular weight | 251.67 g/mol |
| IUPAC name | 6-(5-amino-2-pyridinyl)pyridine-3-carboxylic acid;hydrochloride |
| InChIKey | OIPGEDQOUIZYAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C(=O)O)C2=NC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)