CAS 871706-85-3 is the registry number for {5-(3-(Trifluoromethyl)phenyl)furan-2-yl}methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanamine (CAS 871706-85-3) is a chemical compound with the molecular formula C12H10F3NO and a molecular weight of 241.21 g/mol. IUPAC name: [5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanamine. InChIKey: IILPHDFBPOMDBG-UHFFFAOYSA-N.
| Molecular formula | C12H10F3NO |
|---|---|
| Molecular weight | 241.21 g/mol |
| IUPAC name | [5-[3-(trifluoromethyl)phenyl]furan-2-yl]methanamine |
| InChIKey | IILPHDFBPOMDBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=CC=C(O2)CN |
Computed by PubChem (NCBI)