Products 1896807-25-2
CAS 1896807-25-2 is the registry number for 1,2,4,6-Tetraphenylpyridinium tetrafluoroborate, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.
4-chloro-3-methyl-1,2-benzoxazole-7-carbaldehyde (CAS 1896807-25-2) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 4-chloro-3-methyl-1,2-benzoxazole-7-carbaldehyde. InChIKey: CLJWMIGXGQDGAV-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 4-chloro-3-methyl-1,2-benzoxazole-7-carbaldehyde |
| InChIKey | CLJWMIGXGQDGAV-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C(C=CC(=C12)Cl)C=O |
Computed by PubChem (NCBI)