CAS 19062-39-6 is the registry number for 3-Amino-2-hydrazinoquinazolin-4(3h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
3-amino-2-hydrazinylquinazolin-4-one (CAS 19062-39-6) is a chemical compound with the molecular formula C8H9N5O and a molecular weight of 191.19 g/mol. IUPAC name: 3-amino-2-hydrazinylquinazolin-4-one. InChIKey: XVRQEQRJAXBHPD-UHFFFAOYSA-N.
| Molecular formula | C8H9N5O |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 3-amino-2-hydrazinylquinazolin-4-one |
| InChIKey | XVRQEQRJAXBHPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C(=N2)NN)N |
Computed by PubChem (NCBI)